![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 94-1-1 abstract.doc | 2024-09-18 10:14 | 28K | |
| 2.pdf | 2024-09-18 10:14 | 11M | |
| 2-Seismic Study of the Chaochou Structure, Pingtung, Taiwan.pdf | 2024-09-18 10:14 | 48M | |
| 1.pdf | 2024-09-18 10:14 | 3.9M | |
| 1-Geology and gravity anomalies of the Pingtung plain.pdf | 2024-09-18 10:14 | 9.0M | |
| (1981) §E¤ô¿ Geomagnetic investigations in the Pingtung plain, Taiwan.pdf | 2024-09-18 10:14 | 12M | |