![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | 1012-2_abstract_A submarine canyon as the cause of a mud volcano-Liuchieuyu Island in Taiwan .pdf | 2024-09-18 10:14 | 42K | |
| 1005-2_abstract_Analysis and Modeling of HVSR in the Presence of a Velocity Inversion_The Case of Venosa, Italy .pdf | 2024-09-18 10:14 | 28K | |
| 0607-1_abstract_Wave field modification by bathymetric anomalies and resulting shoreline changes-a review with recent results.pdf | 2024-09-18 10:14 | 71K | |
| 0111-1_abstract_Fluvial landscape response time how plausible is steady-state denudation.pdf | 2024-09-18 10:14 | 98K | |
| 0329-2_abstract_Magnetotelluric images of deep crustal structure of the Rehai geothermal field near Tengchong, southern China.pdf | 2024-09-18 10:14 | 39K | |
| 0329-1_abstract_Characteristics and development of the flexural forebulge and basal unconformity of Western Taiwan Foreland Basin.pdf | 2024-09-18 10:14 | 42K | |
| 1116-1_abstract_Shallow subduction zone earthquakes and their tsunamigenic potential.pdf | 2024-09-18 10:14 | 39K | |
| 0315-1_abstract_Detection of shoreline changes for tideland areas using multi-temporal satellite images.pdf | 2024-09-18 10:14 | 66K | |
| 1228-1_abstract_Flower structure and strike-slip deformation off southwestern taiwan.pdf | 2024-09-18 10:14 | 130K | |
| 1228-1_abstract_Structural features off southwestern Taiwan.pdf | 2024-09-18 10:14 | 91K | |
| 0104-1_abstract_Contractional_transcurrent_rotational and extensional tectonics_examples from Northern Taiwan .pdf | 2024-09-18 10:14 | 73K | |
| 1012-1_abstract_Resistivity structure of a seismic gap along the Atotsugawa Fault, Japan.pdf | 2024-09-18 10:14 | 45K | |
| 1123-1_abstract_Seismological evidence for nonlinear elastic ground Behavior during large earthquakes.pdf | 2024-09-18 10:14 | 84K | |
| 1109-1_abstract_Assessmentofcrustalvelocitymodelsusingseismicrefractionandreflectiontomtgraphy.pdf | 2024-09-18 10:14 | 85K | |
| 1026-1_abstract_High-resolution magnetostratigrap-hy of late Quaternary sediments from1026-1_ LakeBaikal-Siberia timing of intracontinental paleoclimatic responses.pdf | 2024-09-18 10:14 | 66K | |
| 1130-2_abstract_Tectonistratigraphic model for underfilled peripheral foreland basins_An Alpine perspective.pdf | 2024-09-18 10:14 | 15K | |
| 1109-1_abstract_CrustalstructureofthesouthernmostRyukyusubductionzoneOBS,MCSandgravitymodelling.pdf | 2024-09-18 10:14 | 40K | |
| 1109-1_abstract_Modelling strategies and model assessment for wide-angle seismic traveltime data.pdf | 2024-09-18 10:14 | 187K | |
| 0315-1_abstract_Topography and morphodynamics in the German Bight using SAR and optical remote sensing data.pdf | 2024-09-18 10:14 | 123K | |
| 1109-2_abstract_Late quaternary sedimentation in the Ulleung Interplain Gap, East Sea (Korea).pdf | 2024-09-18 10:14 | 60K | |
| 1207-1_abstract_Atmospheric sources for audio-magnetotelluric (AMT) sounding.pdf | 2024-09-18 10:14 | 35K | |
| 1207-1_abstract_A new methodology for the acquisition and processing of audio-magnetotelluric (AMT) data in the AMT dead band.pdf | 2024-09-18 10:14 | 36K | |
| 1130-1_abstarct_Structure and Motion of the Southwestern Taiwan Fold and Thrust Belt.pdf | 2024-09-18 10:14 | 71K | |
| 0329-1_abstract_Stratigraphic architecture magnetostratigraphy and incised-valley systems of the Pliocene-Pleistocene collisional marine foreland basin of Taiwan.pdf | 2024-09-18 10:14 | 24K | |
| 1012-2_abstract_The Liuchiu Hsu island offshore SW Taiwan tectonic versusdiapiric anticline development and comparisonswith onshore structures.pdf | 2024-09-18 10:14 | 76K | |
| 1109-2_abstract_Marine sediment classification using the chirp sonar.pdf | 2024-09-18 10:14 | 94K | |
| 1116-2_abstract_A digital elevation model of the inter-tidal areas of the Wash, England, produced by the waterline method.pdf | 2024-09-18 10:14 | 68K | |
| 0315-2_abstract_Stochastic prediction of ground motion and spectral response parameters at hard-rock sites in eastern North America.pdf | 2024-09-18 10:14 | 80K | |
| 1228-2_abstract_Resistivity Structures of the Chelungpu Fault in the Taichung.pdf | 2024-09-18 10:14 | 330K | |
| 0329-2_abstract_Exploration of geothermal structure in Puga geothermal field, Ladakh Himalayas, India by magnetotelluric studies.pdf | 2024-09-18 10:14 | 72K | |
| 0928-2_abstract_Stochastic Finite-Fault Modeling of Ground Motions from the 1994 Northridge, California, Earthquake. I. Validation on Rock Sites.pdf | 2024-09-18 10:14 | 88K | |
| 0308-2_abstract_Run-up heights of nearshore tsunamis basedon quadtree grid system.pdf | 2024-09-18 10:14 | 55K | |
| 0111-1_abstract_On steady states in mountain belts.pdf | 2024-09-18 10:14 | 104K | |
| 1123-1_abstract_Evidence of nonlinear site response in HVSR from SMART1 (Taiwan) data.pdf | 2024-09-18 10:14 | 61K | |
| 1026-1_abstract_Detrital input and early diagenesis in sedimentsfromLake Baikal revealed by rock magnetism.pdf | 2024-09-18 10:14 | 63K | |
| 1116-1_abstract_Complex earthquake rupture and local tsunamis.pdf | 2024-09-18 10:14 | 584K | |
| 0308-2_abstarct_Analytical and numerical study of nonlinear effects at tsunami modeling.pdf | 2024-09-18 10:14 | 69K | |
| 0928-2_abstract_Stochastic Finite-Fault Modeling of Ground Motions from the 1994 Northridge, California, Earthquake. II.Widespread Nonlinear Response at Soil Sites.pdf | 2024-09-18 10:14 | 101K | |
| 0315-2_abstract_Estimation of ground motion at deep-soil sites in eastern North America.pdf | 2024-09-18 10:14 | 73K | |
| 1012-1_abstract_Deep resistivity sounding studies in detecting shear zones ,A case study from the southern granulite terrain of India.pdf | 2024-09-18 10:14 | 58K | |
|
|---|