![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | 1231-2_abstract_Sedimentary environmentrigin of kaolin-rich mudstones.pdf | 2024-09-18 10:13 | 291K | |
![[ ]](/icons/layout.gif) | 1231-1_abstract_GravityTutoria-Ellipsoivity, geodesy, and geophysicsl.pdf | 2024-09-18 10:13 | 35K | |
![[ ]](/icons/layout.gif) | 1231-1_abstract_Effect_of_the_SRTM_globoid_model_a_case_study_in_Iran.pdf | 2024-09-18 10:14 | 70K | |
![[ ]](/icons/layout.gif) | 1231-1_abstract_DEM-induced_errors_in_da_quasi-geoid_model_for_Africa.pdf | 2024-09-18 10:13 | 110K | |
![[ ]](/icons/layout.gif) | 1224-2_abstract_Paleoenvironments, source rock potential and thermal maturity f the Upper Benue rift basins, Nigeria implications for hydrocarbon exploration.pdf | 2024-09-18 10:13 | 61K | |
![[ ]](/icons/layout.gif) | 1224-2_abstract_A geochemical study ofmacerals from a Miocene lignite and an Eocene bituminous coal, Indonesia.pdf | 2024-09-18 10:13 | 58K | |
![[ ]](/icons/layout.gif) | 1224-1_abstract_Transformed Coherence Ftions for Multivariate Studies.pdf | 2024-09-18 10:13 | 149K | |
![[ ]](/icons/layout.gif) | 1224-1_abstract_The estimation of magnesor elements from measure data.pdf | 2024-09-18 10:13 | 75K | |
![[ ]](/icons/layout.gif) | 1224-1_abstract_On the Robust Estimatiorences, and Transfer Functions.pdf | 2024-09-18 10:13 | 98K | |
![[ ]](/icons/layout.gif) | 1224-1_abstract_Magnetotellurics with a remote magnetic reference.pdf | 2024-09-18 10:14 | 79K | |
![[ ]](/icons/layout.gif) | 1224-1_abstract_Improving Bahr’s invariameters using the WAL approach.pdf | 2024-09-18 10:14 | 50K | |
![[ ]](/icons/layout.gif) | 1224-1_abstract_Improving Bahrs invariameters using the WAL approach.pdf | 2024-09-18 10:14 | 50K | |
![[ ]](/icons/layout.gif) | 1224-1_abstract_Geological noise in magsification of distortion types.pdf | 2024-09-18 10:14 | 87K | |
![[ ]](/icons/layout.gif) | 1224-1_abstract_A Comparison of Techniqc response function estimation.pdf | 2024-09-18 10:14 | 106K | |
![[ ]](/icons/layout.gif) | 1210-2_abstract_Tectonic features associated with the overriding of an accretionary wedge on top of a rifted continental margin An example from Taiwan.pdf | 2024-09-18 10:13 | 59K | |
![[ ]](/icons/layout.gif) | 1210-2_abstract_Geological controls on BSR occurrences in the incipient arc-continent collision zone off southwest Taiwan.pdf | 2024-09-18 10:14 | 53K | |
![[ ]](/icons/layout.gif) | 1203-2_abstract_Inversion tectonics andn of the Northern Taihsi Basin 1.pdf | 2024-09-18 10:14 | 47K | |
![[ ]](/icons/layout.gif) | 1203-2_abstract_Geometrical Charaterist the Offshore of Miaoli Taiwan.pdf | 2024-09-18 10:13 | 39K | |
![[ ]](/icons/layout.gif) | 1203-1_abstract_Seal integrity and feasiblity of CO2 sequestration in the Teapot Dome EOR pilot_geomechanical site characterization.pdf | 2024-09-18 10:14 | 30K | |
![[ ]](/icons/layout.gif) | 1203-1_abstract_Fault reactivation, leakage potential, and hydrocarbon column heights in the northern North Sea.pdf | 2024-09-18 10:14 | 277K | |
![[ ]](/icons/layout.gif) | 1119-2_abstract_The crust and upper manferred from receiver functions.pdf | 2024-09-18 10:13 | 38K | |
![[ ]](/icons/layout.gif) | 1119-2_abstract_Moho depth variation inteleseismic receiver functions.pdf | 2024-09-18 10:14 | 227K | |
![[ ]](/icons/layout.gif) | 1119-1_abstract_Tidal triggering of micthquakes on Juan de Fuca ridge .pdf | 2024-09-18 10:13 | 53K | |
![[ ]](/icons/layout.gif) | 1119-1_abstract_Earth tides as a triggeing mechanism for earthquakes.pdf | 2024-09-18 10:14 | 79K | |
![[ ]](/icons/layout.gif) | 1112-2_abstract_Reviews_on_foreland_tectonics_Taiwan.pdf | 2024-09-18 10:13 | 54K | |
![[ ]](/icons/layout.gif) | 1112-2_abstract_Magnitude of Cenozoic e transit time, offshore Taiwan.pdf | 2024-09-18 10:13 | 41K | |
![[ ]](/icons/layout.gif) | 1112-1_abstract_The Neo-tectonic structtern tip of the Okinawa Trough.pdf | 2024-09-18 10:14 | 30K | |
![[ ]](/icons/layout.gif) | 1112-1_abstract_The 2005 Ilan earthquakpagation of the Okinawa Trough.pdf | 2024-09-18 10:13 | 40K | |
![[ ]](/icons/layout.gif) | 1112-1_abstract_Insight into the Geotheure in Chingshui, Ilan, Taiwan.pdf | 2024-09-18 10:14 | 44K | |
![[ ]](/icons/layout.gif) | 1105-2_abstract_Is the sequence of earthquake in southern California, with aftershocks removed, Poissonian.pdf | 2024-09-18 10:13 | 73K | |
![[ ]](/icons/layout.gif) | 1105-2_abstract_A review of earthquake occurence models for seismic harzard analysis.pdf | 2024-09-18 10:13 | 103K | |
![[ ]](/icons/layout.gif) | 1105-1_abstract_Aftershock modeling based on uncertain stress calculations.pdf | 2024-09-18 10:14 | 58K | |
![[ ]](/icons/layout.gif) | 1105-1_abstract_A constitutive law for rate of earthquake production and its application to earthquake clustering.pdf | 2024-09-18 10:14 | 109K | |
![[ ]](/icons/layout.gif) | 1029-2_abstract_Seismological evidence avior during large earthquakes.pdf | 2024-09-18 10:13 | 92K | |
![[ ]](/icons/layout.gif) | 1029-2_abstract_Nonlinearity, Liquefactthe Hyogo-ken Nanbu Earthquake.pdf | 2024-09-18 10:13 | 106K | |
![[ ]](/icons/layout.gif) | 1029-1_abstract_Paleosols in clastic se - their geologic applications.pdf | 2024-09-18 10:13 | 41K | |
![[ ]](/icons/layout.gif) | 1029-1_abstract_Eustatic Control on Allional Park, West Texas, U.S.A..pdf | 2024-09-18 10:14 | 19K | |
![[ ]](/icons/layout.gif) | 1022-2_abstract_The conversion of smectfrom bentonites and sandstones.pdf | 2024-09-18 10:13 | 91K | |
![[ ]](/icons/layout.gif) | 1022-2_abstract_Diagenesis and reservois in the Vienna Basin, Austria.pdf | 2024-09-18 10:13 | 84K | |
![[ ]](/icons/layout.gif) | 1022-1_abstract_Shoreline Feature Extran from Remotely-Sensed Imagery.pdf | 2024-09-18 10:13 | 79K | |
![[ ]](/icons/layout.gif) | 1022-1_abstract_Nonlinear image labeling for multivalued segmentation.pdf | 2024-09-18 10:13 | 134K | |
![[ ]](/icons/layout.gif) | 1022-1_abstract_Coastline extraction frion of the coastline precision.pdf | 2024-09-18 10:13 | 209K | |
![[ ]](/icons/layout.gif) | 1015-2_abstract_Stable hydrogen isotopic composition of hydrocarbons in torbanites (Late Carboniferous to Late Permian) deposited under various climatic conditions.pdf | 2024-09-18 10:13 | 135K | |
![[ ]](/icons/layout.gif) | 1015-2_abstract_Organic geochemical characterization of the density fractions of a Permian torbanite.pdf.pdf | 2024-09-18 10:14 | 52K | |
![[ ]](/icons/layout.gif) | 1015-1_abstract_Partial melt or aqueousm INDEPTH magnetotelluric data.pdf | 2024-09-18 10:13 | 49K | |
![[ ]](/icons/layout.gif) | 1015-1_abstract_Magnetotelluric evidenced tectonics in central Taiwan.pdf | 2024-09-18 10:13 | 344K | |
![[ ]](/icons/layout.gif) | 1015-1_abstract_Estimating depth of inv dc resistivity and IP surveys.pdf | 2024-09-18 10:14 | 63K | |
![[ ]](/icons/layout.gif) | 1008-2_abstract_The geological interpretation of side-scan sonar.pdf | 2024-09-18 10:13 | 99K | |
![[ ]](/icons/layout.gif) | 1008-2_abstract_Geophysical constraints Ridge region, Cascadia margin.pdf | 2024-09-18 10:13 | 134K | |
![[ ]](/icons/layout.gif) | 1008-1_abstract_Seismicity and tectonics of western Venezuela.pdf | 2024-09-18 10:13 | 74K | |
![[ ]](/icons/layout.gif) | 1008-1_abstract_A double-difference earhern Hayward Fault, California.pdf | 2024-09-18 10:14 | 32K | |
![[ ]](/icons/layout.gif) | 1001-2_abstract_Styles of positive invenics in the Central Apennines.pdf | 2024-09-18 10:13 | 69K | |
![[ ]](/icons/layout.gif) | 1001-2_abstract_Geometry and kinematics of inversion tectonics.pdf | 2024-09-18 10:13 | 87K | |
![[ ]](/icons/layout.gif) | 1001-1_abstract_Subsurface structure, physical properties, fault-zone characteristics and stress state in scientific drill holes of TCDP.pdf | 2024-09-18 10:14 | 66K | |
![[ ]](/icons/layout.gif) | 1001-1_abstract_In-situ stress field and fault reactivation in the Mutineer and Exeter Fields, Australian North West Shelf.pdf | 2024-09-18 10:13 | 102K | |
![[ ]](/icons/layout.gif) | 0422-2_abstract_利用時頻分析技術檢視土壤非線性反應.pdf | 2024-09-18 10:14 | 211K | |
![[ ]](/icons/layout.gif) | 0422-2_abstract_QήWRN˵g[Duʤ.pdf | 2024-09-18 10:14 | 211K | |
![[ ]](/icons/layout.gif) | 0408-2_abstract_The geological interpretation of sidescan sonar 1.pdf | 2024-09-18 10:14 | 95K | |
![[ ]](/icons/layout.gif) | 0408-2_abstract_Tectonic features associated with the overriding of an accretionary wedge on top of a.pdf | 2024-09-18 10:13 | 59K | |
![[ ]](/icons/layout.gif) | 0408-1_abstract_6Magnetic Survey of TaiPrelim inary Inter pre tations.pdf | 2024-09-18 10:13 | 61K | |
![[ ]](/icons/layout.gif) | 0408-1_abstract_5Estimating depth of in dc resistivity and IP surveys.pdf | 2024-09-18 10:13 | 63K | |
![[ ]](/icons/layout.gif) | 0408-1_abstract_4Crustal Resistivity An Beneath Central Taiwan Imaged.pdf | 2024-09-18 10:14 | 329K | |
![[ ]](/icons/layout.gif) | 0408-1_abstract_3Preliminary result of sible detection of dehydration.pdf | 2024-09-18 10:14 | 73K | |
![[ ]](/icons/layout.gif) | 0408-1_abstract_1Magnetotelluric evidened tectonics in central Taiwan.pdf | 2024-09-18 10:13 | 344K | |
![[ ]](/icons/layout.gif) | 0325-2_abstract_Organic geological characterization of the density fractions of a Permian torbanite.pdf | 2024-09-18 10:13 | 97K | |
![[ ]](/icons/layout.gif) | 0325-2_abstract_Omura&Hoyanagi_2006_JSR_organic matter and environments 1.pdf | 2024-09-18 10:13 | 21K | |
![[ ]](/icons/layout.gif) | 0325-1_abstract_Relationships between composition organic matter, depositional environments and sea-level changes in back arc basins, central Japan.pdf | 2024-09-18 10:14 | 154K | |
![[ ]](/icons/layout.gif) | 0325-1_abstract_Organic geological characterization of the density fractions of s Permian torbanite.pdf | 2024-09-18 10:14 | 52K | |
![[ ]](/icons/layout.gif) | 0318-2_abstract_Inversion tectonics and evolution of the Northern Taihsi Basin.pdf | 2024-09-18 10:13 | 49K | |
![[ ]](/icons/layout.gif) | 0318-2_abstract_Geometrical Charateristics of Structutral Inversion on the Offshore of Miaoli Taiwan.pdf | 2024-09-18 10:13 | 42K | |
![[ ]](/icons/layout.gif) | 0318-1_abstract_Estimation of minimum principal stress from an extended leak-off test onboard the Chikyu drilling vessel and suggestions for future test pr.pdf | 2024-09-18 10:14 | 221K | |
![[ ]](/icons/layout.gif) | 0318-1_abstract_Constraining stress magnitudes using petroleum exploration data in the Cooper-Eromanga Basins_Australia.pdf | 2024-09-18 10:13 | 58K | |
![[ ]](/icons/layout.gif) | 0311-2_abstract_ Moho depth variation in Taiwan from teleseismic receiver functions..pdf | 2024-09-18 10:14 | 108K | |
![[ ]](/icons/layout.gif) | 0311-2_abstract_A preliminary study of crustal structure in Taiwan region using receiver function analysis.pdf | 2024-09-18 10:13 | 43K | |
![[ ]](/icons/layout.gif) | 0311-1_abstract_The empirical mode decomposition and the Hilbert spectrum for nonlinear and nonstationary time series analysis.pdf | 2024-09-18 10:13 | 156K | |
![[ ]](/icons/layout.gif) | 0311-1_abstract_A confidence limit for the empirical mode decomposition and Hilbert spectral analysis.pdf | 2024-09-18 10:13 | 103K | |
![[ ]](/icons/layout.gif) | 0304-2_abstract_Using a genetic algoritFuerteventura (Canary Islands).pdf | 2024-09-18 10:13 | 113K | |
![[ ]](/icons/layout.gif) | 0304-2_abstract_Gravity inversion by means of growing bodies .pdf | 2024-09-18 10:13 | 50K | |
![[ ]](/icons/layout.gif) | 0304-1_abstract_Seismic tomography of Twork of strong motion stations.pdf | 2024-09-18 10:13 | 52K | |
![[ ]](/icons/layout.gif) | 0304-1_abstract_Improved seismic tomogran and the southernmost Ryukyu.pdf | 2024-09-18 10:14 | 40K | |
![[ ]](/icons/layout.gif) | 0225-2_abstract_Minimum Magnitude of Costern United States, and Japan.pdf | 2024-09-18 10:14 | 27K | |
![[ ]](/icons/layout.gif) | 0225-2_abstract_Estimation of parameters for recurrence models of earthquakes.pdf | 2024-09-18 10:13 | 603K | |
![[ ]](/icons/layout.gif) | 0225-1_abstract_The use of earthquake rstressmeter at Kilauea volcano.pdf | 2024-09-18 10:14 | 138K | |
![[ ]](/icons/layout.gif) | 0225-1_abstract_Evolution of the stresshquakes A 200-year perspective.pdf | 2024-09-18 10:14 | 106K | |
![[ ]](/icons/layout.gif) | 0107-2_abstract_Site Amplification at Five LocWaves Codas and Microtremors.pdf | 2024-09-18 10:13 | 111K | |
![[ ]](/icons/layout.gif) | 0107-2_abstract_A Method for Dynamic Characterrotremor on the Ground Surface.pdf | 2024-09-18 10:14 | 96K | |
![[ ]](/icons/layout.gif) | 0107-1_abstract_TIDE-DOMINATED VERSUS TIDE-INFLUENCED DELTAS 1.pdf | 2024-09-18 10:13 | 63K | |
![[ ]](/icons/layout.gif) | 0107-1_abstract_ICHNOLOGY AND SEDIMENTO A MUD-DOMINATED DELTAIC COAST 1.pdf | 2024-09-18 10:13 | 74K | |
|