![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | 0106-1_abstract_Sedimeure Congo turbidite channel(2) 1.pdf | 2024-09-18 10:14 | 62K | |
![[IMG]](/icons/image2.gif) | 0106-2_abstract_Basin architecture and tectonic mode in offshore areas of central Taiwan.jpg | 2024-09-18 10:14 | 499K | |
![[ ]](/icons/layout.gif) | 0106-2_abstract_Stratigraphy of Cenozoic sequences in Taiwan Strait and southern East China Sea .pdf | 2024-09-18 10:14 | 44K | |
![[ ]](/icons/layout.gif) | 0113-1_abstract_Recogni in mixed contourite-turbidite 1.pdf | 2024-09-18 10:14 | 37K | |
![[ ]](/icons/layout.gif) | 0113-1_abstract_Upper Qte versus contourite processes 1.pdf | 2024-09-18 10:14 | 136K | |
![[ ]](/icons/layout.gif) | 0113-2_abstract_Atmospheric and oceanic erth's wobbles during 1980-2000 1.pdf | 2024-09-18 10:14 | 46K | |
![[ ]](/icons/layout.gif) | 0113-2_abstract_Sea Surface Elevation ands due to Thermohaline Forcing. 1.pdf | 2024-09-18 10:14 | 18K | |
![[ ]](/icons/layout.gif) | 0224-1_abstract_A Method for Dynamic Chrotremor on the Ground Surface 1.pdf | 2024-09-18 10:14 | 13K | |
![[ ]](/icons/layout.gif) | 0224-1_abstract_Comparison of Site Respics Inferred from Microtremors 1.pdf | 2024-09-18 10:14 | 25K | |
![[ ]](/icons/layout.gif) | 0224-2_abstract_Estimation of period and Q of the Chandler wobble 1.pdf | 2024-09-18 10:14 | 116K | |
![[ ]](/icons/layout.gif) | 0224-2_abstract_Linear drift and periodng time series of polar motion 1.pdf | 2024-09-18 10:14 | 57K | |
![[ ]](/icons/layout.gif) | 0224-2_abstract_autoregressive harmonicnational latitude service data 1.pdf | 2024-09-18 10:14 | 112K | |
![[ ]](/icons/layout.gif) | 0303-1_abstract_Estimating source parameters from deformation data, with an application to the March 1997 earthquake swarm off the Izu Peninsula.pdf | 2024-09-18 10:14 | 95K | |
![[ ]](/icons/layout.gif) | 0310-1_abstract_Basement Imaging Using rray in Lan-Yang Plain, Taiwan 1.pdf | 2024-09-18 10:14 | 33K | |
![[ ]](/icons/layout.gif) | 0310-1_abstract_The 2005 Ilan earthquakpagation of the Okinawa Trough 1.pdf | 2024-09-18 10:14 | 40K | |
![[ ]](/icons/layout.gif) | 0310-2_abstract_FIRST-BREAK INTERPRETATG GENERALIZED LINEAR INVERSION 1.pdf | 2024-09-18 10:14 | 81K | |
![[ ]](/icons/layout.gif) | 0310-2_abstract_Shallow velocityˇVdepth CO2SINK site, Ketzin, Germany 1.pdf | 2024-09-18 10:14 | 72K | |
![[ ]](/icons/layout.gif) | 0310-2_abstract_Shallow velocity–depth CO2SINK site, Ketzin, Germany 1.pdf | 2024-09-18 10:14 | 72K | |
![[ ]](/icons/layout.gif) | 0316-1_abstract_Noise in GPS displacemeCalifornia and Southern Nevada 1.pdf | 2024-09-18 10:14 | 53K | |
![[ ]](/icons/layout.gif) | 0316-1_abstract_correlated errors in geodetic for time-dependent deformation.pdf | 2024-09-18 10:14 | 100K | |
![[ ]](/icons/layout.gif) | 0317-2_abstract_New insights on 3-D plaphy and tectonic implications 1.pdf | 2024-09-18 10:14 | 45K | |
![[ ]](/icons/layout.gif) | 0317-2_abstract_Tomographic imaging of pheric structures under Taiwan 1.pdf | 2024-09-18 10:14 | 81K | |
![[ ]](/icons/layout.gif) | 0930-1_abstract_Validation of Spatial Prediction Models for Landslide Hazard Mapping.pdf | 2024-09-18 10:14 | 34K | |
![[ ]](/icons/layout.gif) | 0930-1_abstract_modeling the conditional probability of the occurrences of future landslides in a study area characterized by spatial data.pdf | 2024-09-18 10:14 | 97K | |
![[ ]](/icons/layout.gif) | 0930-2_abstract_Data reduction in scalane gravimetry Theory, software .pdf | 2024-09-18 10:14 | 73K | |
![[ ]](/icons/layout.gif) | 0930-2_abstract_Geodetic and geophysicafrom a Taiwan airborne gravity.pdf | 2024-09-18 10:14 | 56K | |
![[ ]](/icons/layout.gif) | 1007-1_abstract_Determination of Source Parameters at Regional Distances With Three-Component Sparse Network Data.pdf | 2024-09-18 10:14 | 89K | |
![[ ]](/icons/layout.gif) | 1007-1_abstract_Source Parameters of Regional Earthquakes in Taiwan 1992-2000 Including the Chi-Chi Earthquake Sequence.pdf | 2024-09-18 10:14 | 7.1K | |
![[ ]](/icons/layout.gif) | 1007-2_abstract_Acoustic density measurements of consolidating cohesive sediment beds by means of a non-intrusive Micro-Chirp acoustic system.pdf | 2024-09-18 10:14 | 271K | |
![[ ]](/icons/layout.gif) | 1007-2_abstract_some applications of the chirp sonar.pdf | 2024-09-18 10:14 | 606K | |
![[ ]](/icons/layout.gif) | 1014-1_abstract_Anomalous Seismic Attenuation ns from a Linear Seismic Array 1.pdf | 2024-09-18 10:14 | 36K | |
![[ ]](/icons/layout.gif) | 1014-1_abstract_Evidence of a highly attenuatiive collision orogen of Taiwan 1.pdf | 2024-09-18 10:14 | 91K | |
![[ ]](/icons/layout.gif) | 1014-2_abstract_Anisotropy in the shalle 2004 M6 Parkfield earthquake.pdf | 2024-09-18 10:14 | 38K | |
![[ ]](/icons/layout.gif) | 1014-2_abstract_Seismic evidence for roe 2004 M6 Parkfield earthquake 1.pdf | 2024-09-18 10:14 | 29K | |
![[ ]](/icons/layout.gif) | 1021-1_abstract_Configuration of the Inn Moho beneath the NW Himalaya 1.pdf | 2024-09-18 10:14 | 56K | |
![[ ]](/icons/layout.gif) | 1021-1_abstract_Partial melt in the upped by Rayleigh wave dispersion 1.pdf | 2024-09-18 10:14 | 74K | |
![[ ]](/icons/layout.gif) | 1021-2_abstract_1984-Rotation of the atmospheres of the Earth and planets 2.pdf | 2024-09-18 10:14 | 147K | |
![[ ]](/icons/layout.gif) | 1021-2_abstract_1985-Chao_GRL1985_On thon of the Earth's polar motion 1.pdf | 2024-09-18 10:14 | 112K | |
![[ ]](/icons/layout.gif) | 1021-2_abstract_1985-Discrete polar motion equations 1.pdf | 2024-09-18 10:14 | 63K | |
![[ ]](/icons/layout.gif) | 1028-1_abstract_Cenozoic stratigraphy aea margin in the Taiwan region 1.pdf | 2024-09-18 10:14 | 46K | |
![[ ]](/icons/layout.gif) | 1028-1_abstract_Origin of the West Taiwof a rifted continental margin 1.pdf | 2024-09-18 10:14 | 42K | |
![[ ]](/icons/layout.gif) | 1028-2_abstract_Grain-size analysis of lacustrine sediments 1.pdf | 2024-09-18 10:14 | 80K | |
![[ ]](/icons/layout.gif) | 1028-2_abstract_Holocene sediments fromench a record of active margin 2.pdf | 2024-09-18 10:14 | 32K | |
![[ ]](/icons/layout.gif) | 1028-2_abstract_New techniques in sedimcore analysis an introduction 1.pdf | 2024-09-18 10:14 | 115K | |
![[ ]](/icons/layout.gif) | 1104-1_abstract_A submarine canyon conduiconditions off Southern Taiwan 1.pdf | 2024-09-18 10:14 | 114K | |
![[ ]](/icons/layout.gif) | 1104-1_abstract_From suspended particles to strata The fate of terrestrial substances in the Gaoping (Kaoping) submarine canyon.pdf | 2024-09-18 10:14 | 87K | |
![[ ]](/icons/layout.gif) | 1104-2_abstract_Crustal deformation across and beyond the Los Angles basin from geodetic measurements.pdf | 2024-09-18 10:14 | 107K | |
![[ ]](/icons/layout.gif) | 1104-2_abstract_Origin and geological evolution of the Taipei Basin, northern Taiwan.pdf | 2024-09-18 10:14 | 132K | |
![[ ]](/icons/layout.gif) | 1104-2_abstract_Strain Accumulation Rates in the Western United States Between 1970 and 1978.pdf | 2024-09-18 10:14 | 110K | |
![[ ]](/icons/layout.gif) | 1104-2_abstract_Surface deformation and tectonic.pdf | 2024-09-18 10:14 | 49K | |
![[ ]](/icons/layout.gif) | 1111-01_abstract_EEW in Japan_warning the general public_Kamigaichi_2009 1.pdf | 2024-09-18 10:14 | 63K | |
![[ ]](/icons/layout.gif) | 1111-01_abstract_Earthquake EarlyWarnin Technology Progress in Taiwan 1.pdf | 2024-09-18 10:14 | 39K | |
![[ ]](/icons/layout.gif) | 1111-02_abstract_Consequences of continforearc basin and accretionary 1.pdf | 2024-09-18 10:14 | 89K | |
![[ ]](/icons/layout.gif) | 1111-02_abstract_Distribution and Charaers of Gas Hydrate Offshore of 1.pdf | 2024-09-18 10:14 | 330K | |
![[ ]](/icons/layout.gif) | 1118-1_abstract_Does extrusion occur an collision belt Insights from 1.pdf | 2024-09-18 10:14 | 90K | |
![[ ]](/icons/layout.gif) | 1118-1_abstract_The crustal dxtension of the Okinawa Trough 1.pdf | 2024-09-18 10:14 | 89K | |
![[ ]](/icons/layout.gif) | 1118-2_abstract_Computation of refractit-break traveltime differences 1.pdf | 2024-09-18 10:14 | 94K | |
![[ ]](/icons/layout.gif) | 1118-2_abstract_Re frac tion Static Cor Pick ing First Ar rival Times 1.pdf | 2024-09-18 10:14 | 59K | |
![[ ]](/icons/layout.gif) | 1202-1_abstract_Crustal evaluation of the nortz. Egypt from geophysical data 1.pdf | 2024-09-18 10:14 | 63K | |
![[ ]](/icons/layout.gif) | 1202-1_abstract_Efficient gravitydatainversionr3Dtopographyofacontactsurface 1.pdf | 2024-09-18 10:14 | 98K | |
![[ ]](/icons/layout.gif) | 1202-1_abstract_Gravity and magnetic data invee northern Red Sea area, Egypt 1.pdf | 2024-09-18 10:14 | 94K | |
![[ ]](/icons/layout.gif) | 1202-2_abstract_2002_dreger 1.pdf | 2024-09-18 10:14 | 28K | |
![[ ]](/icons/layout.gif) | 1202-2_abstract_On the realtime monitoring of the long-period seismic wavefield.pdf | 2024-09-18 10:14 | 51K | |
![[ ]](/icons/layout.gif) | 1209-1_abstract_Displacement of Surface Monuments Horizontal Motion 1.pdf | 2024-09-18 10:14 | 114K | |
![[ ]](/icons/layout.gif) | 1209-1_abstract_Displacemento f SurfaceM onuments Vertical Motion 1.pdf | 2024-09-18 10:14 | 115K | |
![[ ]](/icons/layout.gif) | 1209-1_abstract_Noise in GPS coordinate time series 1.pdf | 2024-09-18 10:14 | 110K | |
![[ ]](/icons/layout.gif) | 1209-2_abstract_Distribution of Gassy Sediments Offshore Southwestern Taiwan 1.pdf | 2024-09-18 10:14 | 365K | |
![[ ]](/icons/layout.gif) | 1209-2_abstract_Gas seepage, pockmarks and mudin the near shore of SW Taiwan 1.pdf | 2024-09-18 10:14 | 83K | |
![[ ]](/icons/layout.gif) | 1223-1_abstract_Landslide Susceptibilitlysis Based on Three Different 1.pdf | 2024-09-18 10:14 | 110K | |
![[ ]](/icons/layout.gif) | 1223-1_abstract_Statistical approach toduced landslide susceptibility 1.pdf | 2024-09-18 10:14 | 106K | |
![[ ]](/icons/layout.gif) | 1223-2_abstract_A Comprehensive Relocatn from 1991 to 2005 by Wu 2008 1.pdf | 2024-09-18 10:14 | 33K | |
![[ ]](/icons/layout.gif) | 1223-2_abstract_Seismic tomography of Twork of strong motion stations 1.pdf | 2024-09-18 10:14 | 55K | |
![[ ]](/icons/layout.gif) | 1230-1_abstract_Anomalous_Pn_Waves_Obsein_Eastern_Taiwan_Implications 1.pdf | 2024-09-18 10:14 | 61K | |
![[ ]](/icons/layout.gif) | 1230-1_abstract_Polarity_Reversal_of_Ac_Elevated_Oceanic_Upper____Kim 1.pdf | 2024-09-18 10:14 | 35K | |
![[ ]](/icons/layout.gif) | 1230-3_A Technique(A).pdf | 2024-09-18 10:14 | 70K | |
![[ ]](/icons/layout.gif) | 1230-4_Shallow crustal structure(A).pdf | 2024-09-18 10:14 | 90K | |
|