![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[TXT]](/icons/text.gif) | Sun, Yuan-Cheng.html | 2024-09-18 10:13 | 3.5K | |
![[ ]](/icons/layout.gif) | Plateau pop up in the great 1897 Assam earthquake.pdf | 2024-09-18 10:13 | 220K | |
| Geophysical inversion with a neighbourhood algorithm.pdf | 2024-09-18 10:13 | 1.3M | |
| Deep geoelectric structure over the Lower Brahmaputra valley and Shillong Plateau NE India using magnetotellurics.pdf | 2024-09-18 10:13 | 928K | |
| Crustal shear-wave velocity structure beneath northeast India from teleseismic receiver functions analysis.pdf | 2024-09-18 10:13 | 7.0M | |
![[ ]](/icons/unknown.gif) | Abstract_Sun_Yuan_Cheng2.docx | 2024-09-18 10:13 | 17K | |
|
|---|